C8H5F4NO — CID 119005001
4-(difluoromethyl)-2,3-difluorobenzamide (PubChem CID 119005001) has the molecular formula C8H5F4NO and a molecular weight of 207.13 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,3-difluorobenzamide.
| Compound Name | 4-(difluoromethyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 119005001 |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.13 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-(difluoromethyl)-2,3-difluorobenzamide |
| SMILES | NC(=O)c1ccc(C(F)F)c(F)c1F |
| InChI | InChI=1S/C8H5F4NO/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14/h1-2,7H,(H2,13,14) |
| InChIKey | AUAXRWFYBOSRBK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |