C12H17F2N3O — CID 165405448
4-[(2S)-3-amino-2-(dimethylamino)propyl]-2,3-difluorobenzamide (PubChem CID 165405448) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 4-[(2S)-3-amino-2-(dimethylamino)propyl]-2,3-difluorobenzamide.
| Compound Name | 4-[(2S)-3-amino-2-(dimethylamino)propyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 165405448 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(2S)-3-amino-2-(dimethylamino)propyl]-2,3-difluorobenzamide |
| SMILES | CN(C)[C@H](CN)Cc1ccc(C(N)=O)c(F)c1F |
| InChI | InChI=1S/C12H17F2N3O/c1-17(2)8(6-15)5-7-3-4-9(12(16)18)11(14)10(7)13/h3-4,8H,5-6,15H2,1-2H3,(H2,16,18)/t8-/m0/s1 |
| InChIKey | UKMHSGWTWLHPLO-QMMMGPOBSA-N |
| XLogP | 0.50 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |