C11H11F2NO2 — CID 144842411
2-[[(E)-but-2-en-2-yl]amino]-3,4-difluorobenzoic acid (PubChem CID 144842411) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 2-[[(E)-but-2-en-2-yl]amino]-3,4-difluorobenzoic acid.
| Compound Name | 2-[[(E)-but-2-en-2-yl]amino]-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 144842411 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[[(E)-but-2-en-2-yl]amino]-3,4-difluorobenzoic acid |
| SMILES | C/C=C(\C)Nc1c(C(=O)O)ccc(F)c1F |
| InChI | InChI=1S/C11H11F2NO2/c1-3-6(2)14-10-7(11(15)16)4-5-8(12)9(10)13/h3-5,14H,1-2H3,(H,15,16)/b6-3+ |
| InChIKey | WHZKMICBPJBVCM-ZZXKWVIFSA-N |
| XLogP | 3.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |