C15H12F3NO2S — CID 22025691
2-(4-ethylsulfanyl-2-fluoroanilino)-3,4-difluorobenzoic acid (PubChem CID 22025691) has the molecular formula C15H12F3NO2S and a molecular weight of 327.33 g/mol. Its IUPAC name is 2-(4-ethylsulfanyl-2-fluoroanilino)-3,4-difluorobenzoic acid.
| Compound Name | 2-(4-ethylsulfanyl-2-fluoroanilino)-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 22025691 |
| Molecular Formula | C15H12F3NO2S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-(4-ethylsulfanyl-2-fluoroanilino)-3,4-difluorobenzoic acid |
| SMILES | CCSc1ccc(Nc2c(C(=O)O)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C15H12F3NO2S/c1-2-22-8-3-6-12(11(17)7-8)19-14-9(15(20)21)4-5-10(16)13(14)18/h3-7,19H,2H2,1H3,(H,20,21) |
| InChIKey | CNYSZULLIDZUMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |