C12H7F2IN2O2 — CID 71104167
3,4-difluoro-2-[(5-iodo-3-pyridinyl)amino]benzoic acid (PubChem CID 71104167) has the molecular formula C12H7F2IN2O2 and a molecular weight of 376.10 g/mol. Its IUPAC name is 3,4-difluoro-2-[(5-iodo-3-pyridinyl)amino]benzoic acid.
| Compound Name | 3,4-difluoro-2-[(5-iodo-3-pyridinyl)amino]benzoic acid |
|---|---|
| PubChem CID | 71104167 |
| Molecular Formula | C12H7F2IN2O2 |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 3,4-difluoro-2-[(5-iodo-3-pyridinyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(F)c1Nc1cncc(I)c1 |
| InChI | InChI=1S/C12H7F2IN2O2/c13-9-2-1-8(12(18)19)11(10(9)14)17-7-3-6(15)4-16-5-7/h1-5,17H,(H,18,19) |
| InChIKey | XYCDOIWJTNCUKW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|