C12F17NO2 — CID 138396400
1,2,4-trifluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-nitrobenzene (PubChem CID 138396400) has the molecular formula C12F17NO2 and a molecular weight of 513.10 g/mol. Its IUPAC name is 1,2,4-trifluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-nitrobenzene.
| Compound Name | 1,2,4-trifluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-nitrobenzene |
|---|---|
| PubChem CID | 138396400 |
| Molecular Formula | C12F17NO2 |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | 1,2,4-trifluoro-3,5-bis(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(C(F)(C(F)(F)F)C(F)(F)F)c(F)c1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F17NO2/c13-3-1(7(16,9(18,19)20)10(21,22)23)4(14)5(15)6(30(31)32)2(3)8(17,11(24,25)26)12(27,28)29 |
| InChIKey | PVICYOGEJBAIKN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|