C17F27NO3 — CID 101047023
1,2,4,5-tetrafluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]-6-nitrobenzene (PubChem CID 101047023) has the molecular formula C17F27NO3 and a molecular weight of 779.14 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]-6-nitrobenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]-6-nitrobenzene |
|---|---|
| PubChem CID | 101047023 |
| Molecular Formula | C17F27NO3 |
| Molecular Weight | 779.14 g/mol |
| Exact Mass | 778.94 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)octyl]-6-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C17F27NO3/c18-2-1(3(19)5(21)6(4(2)20)45(46)47)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)12(32,33)13(34,35)17(43,44)48-14(36,15(37,38)39)16(40,41)42 |
| InChIKey | ORKQDPKFYCKHEK-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.14 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|