C16F25NO5S — CID 101047018
1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(2,3,5,6-tetrafluoro-4-nitrophenyl)octoxy]ethanesulfonyl fluoride (PubChem CID 101047018) has the molecular formula C16F25NO5S and a molecular weight of 793.19 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(2,3,5,6-tetrafluoro-4-nitrophenyl)octoxy]ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(2,3,5,6-tetrafluoro-4-nitrophenyl)octoxy]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 101047018 |
| Molecular Formula | C16F25NO5S |
| Molecular Weight | 793.19 g/mol |
| Exact Mass | 792.91 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-(2,3,5,6-tetrafluoro-4-nitrophenyl)octoxy]ethanesulfonyl fluoride |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)F)c(F)c1F |
| InChI | InChI=1S/C16F25NO5S/c17-2-1(3(18)5(20)6(4(2)19)42(43)44)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)13(33,34)14(35,36)47-15(37,38)16(39,40)48(41,45)46 |
| InChIKey | FTMPTFVFOAANBD-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.19 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|