C10HF12NO6S — CID 101047029
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-nitrophenyl)ethoxy]ethanesulfonic acid (PubChem CID 101047029) has the molecular formula C10HF12NO6S and a molecular weight of 491.16 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-nitrophenyl)ethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-nitrophenyl)ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 101047029 |
| Molecular Formula | C10HF12NO6S |
| Molecular Weight | 491.16 g/mol |
| Exact Mass | 490.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluoro-4-nitrophenyl)ethoxy]ethanesulfonic acid |
| SMILES | O=[N+]([O-])c1c(F)c(F)c(C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C10HF12NO6S/c11-2-1(3(12)5(14)6(4(2)13)23(24)25)7(15,16)8(17,18)29-9(19,20)10(21,22)30(26,27)28/h(H,26,27,28) |
| InChIKey | OWHMNKMGPJKDMR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|