C13H10ClF2N3O3 — CID 90429708
1-chloro-2-(2,5-difluoro-4-nitrophenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one (PubChem CID 90429708) has the molecular formula C13H10ClF2N3O3 and a molecular weight of 329.69 g/mol. Its IUPAC name is 1-chloro-2-(2,5-difluoro-4-nitrophenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one.
| Compound Name | 1-chloro-2-(2,5-difluoro-4-nitrophenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one |
|---|---|
| PubChem CID | 90429708 |
| Molecular Formula | C13H10ClF2N3O3 |
| Molecular Weight | 329.69 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-chloro-2-(2,5-difluoro-4-nitrophenyl)-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one |
| SMILES | O=c1c(-c2cc(F)c([N+](=O)[O-])cc2F)c(Cl)n2n1CCCC2 |
| InChI | InChI=1S/C13H10ClF2N3O3/c14-12-11(13(20)18-4-2-1-3-17(12)18)7-5-9(16)10(19(21)22)6-8(7)15/h5-6H,1-4H2 |
| InChIKey | WNRZQTHIDDYKAS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|