C20H23ClFN3O6 — CID 144704797
ethyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]pentanoate (PubChem CID 144704797) has the molecular formula C20H23ClFN3O6 and a molecular weight of 455.87 g/mol. Its IUPAC name is ethyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]pentanoate.
| Compound Name | ethyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]pentanoate |
|---|---|
| PubChem CID | 144704797 |
| Molecular Formula | C20H23ClFN3O6 |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | ethyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]pentanoate |
| SMILES | CCCC(Oc1cc(F)c(-c2c(Cl)n3n(c2=O)CCCC3)cc1[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C20H23ClFN3O6/c1-3-7-15(20(27)30-4-2)31-16-11-13(22)12(10-14(16)25(28)29)17-18(21)23-8-5-6-9-24(23)19(17)26/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | GMYQJXQNDLZVBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 105.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|