C22H25Cl2FN2O5 — CID 90434408
propyl (E)-4-[2-chloro-5-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate (PubChem CID 90434408) has the molecular formula C22H25Cl2FN2O5 and a molecular weight of 487.36 g/mol. Its IUPAC name is propyl (E)-4-[2-chloro-5-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate.
| Compound Name | propyl (E)-4-[2-chloro-5-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate |
|---|---|
| PubChem CID | 90434408 |
| Molecular Formula | C22H25Cl2FN2O5 |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | propyl (E)-4-[2-chloro-5-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-4-fluorophenoxy]-3-ethoxybut-2-enoate |
| SMILES | CCCOC(=O)/C=C(\COc1cc(-c2c(Cl)n3n(c2=O)CCCC3)c(F)cc1Cl)OCC |
| InChI | InChI=1S/C22H25Cl2FN2O5/c1-3-9-31-19(28)10-14(30-4-2)13-32-18-11-15(17(25)12-16(18)23)20-21(24)26-7-5-6-8-27(26)22(20)29/h10-12H,3-9,13H2,1-2H3/b14-10+ |
| InChIKey | WCMUZXFGJRCQKR-GXDHUFHOSA-N |
| XLogP | 4.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|