C17H17ClFN3O7 — CID 90429632
methyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]-2-methoxyacetate (PubChem CID 90429632) has the molecular formula C17H17ClFN3O7 and a molecular weight of 429.79 g/mol. Its IUPAC name is methyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]-2-methoxyacetate.
| Compound Name | methyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]-2-methoxyacetate |
|---|---|
| PubChem CID | 90429632 |
| Molecular Formula | C17H17ClFN3O7 |
| Molecular Weight | 429.79 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | methyl 2-[4-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-5-fluoro-2-nitrophenoxy]-2-methoxyacetate |
| SMILES | COC(=O)C(OC)Oc1cc(F)c(-c2c(Cl)n3n(c2=O)CCCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClFN3O7/c1-27-16(24)17(28-2)29-12-8-10(19)9(7-11(12)22(25)26)13-14(18)20-5-3-4-6-21(20)15(13)23/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | OVVJTSYDHOPYKD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|