C17H9F6NO5 — CID 169031252
methyl 1-[5-fluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]cyclopropane-1-carboxylate (PubChem CID 169031252) has the molecular formula C17H9F6NO5 and a molecular weight of 421.25 g/mol. Its IUPAC name is methyl 1-[5-fluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[5-fluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 169031252 |
| Molecular Formula | C17H9F6NO5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | methyl 1-[5-fluoro-2-nitro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Oc2cc(F)c(-c3c(F)c(F)c(F)c(F)c3F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H9F6NO5/c1-28-16(25)17(2-3-17)29-9-5-7(18)6(4-8(9)24(26)27)10-11(19)13(21)15(23)14(22)12(10)20/h4-5H,2-3H2,1H3 |
| InChIKey | CJNFSAVBBKGNLI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|