C11H9F2NO5 — CID 167514643
methyl 4,7-difluoro-2-hydroxy-5-nitro-1,3-dihydroindene-2-carboxylate (PubChem CID 167514643) has the molecular formula C11H9F2NO5 and a molecular weight of 273.19 g/mol. Its IUPAC name is methyl 4,7-difluoro-2-hydroxy-5-nitro-1,3-dihydroindene-2-carboxylate.
| Compound Name | methyl 4,7-difluoro-2-hydroxy-5-nitro-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 167514643 |
| Molecular Formula | C11H9F2NO5 |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | methyl 4,7-difluoro-2-hydroxy-5-nitro-1,3-dihydroindene-2-carboxylate |
| SMILES | COC(=O)C1(O)Cc2c(F)cc([N+](=O)[O-])c(F)c2C1 |
| InChI | InChI=1S/C11H9F2NO5/c1-19-10(15)11(16)3-5-6(4-11)9(13)8(14(17)18)2-7(5)12/h2,16H,3-4H2,1H3 |
| InChIKey | FYXPGTOKDKPAIA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|