C8H4ClF2NO6S — CID 79773539
methyl 3-chlorosulfonyl-2,6-difluoro-5-nitrobenzoate (PubChem CID 79773539) has the molecular formula C8H4ClF2NO6S and a molecular weight of 315.64 g/mol. Its IUPAC name is methyl 3-chlorosulfonyl-2,6-difluoro-5-nitrobenzoate.
| Compound Name | methyl 3-chlorosulfonyl-2,6-difluoro-5-nitrobenzoate |
|---|---|
| PubChem CID | 79773539 |
| Molecular Formula | C8H4ClF2NO6S |
| Molecular Weight | 315.64 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | methyl 3-chlorosulfonyl-2,6-difluoro-5-nitrobenzoate |
| SMILES | COC(=O)c1c(F)c([N+](=O)[O-])cc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C8H4ClF2NO6S/c1-18-8(13)5-6(10)3(12(14)15)2-4(7(5)11)19(9,16)17/h2H,1H3 |
| InChIKey | GKMCAQWHOWDODT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|