C9H9F2N3O5S — CID 79773474
2,6-difluoro-N,N-dimethyl-3-nitro-5-sulfamoylbenzamide (PubChem CID 79773474) has the molecular formula C9H9F2N3O5S and a molecular weight of 309.25 g/mol. Its IUPAC name is 2,6-difluoro-N,N-dimethyl-3-nitro-5-sulfamoylbenzamide.
| Compound Name | 2,6-difluoro-N,N-dimethyl-3-nitro-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 79773474 |
| Molecular Formula | C9H9F2N3O5S |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2,6-difluoro-N,N-dimethyl-3-nitro-5-sulfamoylbenzamide |
| SMILES | CN(C)C(=O)c1c(F)c([N+](=O)[O-])cc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C9H9F2N3O5S/c1-13(2)9(15)6-7(10)4(14(16)17)3-5(8(6)11)20(12,18)19/h3H,1-2H3,(H2,12,18,19) |
| InChIKey | NMZIOBJISVHXOK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|