C18H16F2N6O10 — CID 5290708
2-fluoro-N,N-dimethyl-4,6-dinitrobenzamide;4-fluoro-N,N-dimethyl-2,6-dinitrobenzamide (PubChem CID 5290708) has the molecular formula C18H16F2N6O10 and a molecular weight of 514.35 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-4,6-dinitrobenzamide;4-fluoro-N,N-dimethyl-2,6-dinitrobenzamide.
| Compound Name | 2-fluoro-N,N-dimethyl-4,6-dinitrobenzamide;4-fluoro-N,N-dimethyl-2,6-dinitrobenzamide |
|---|---|
| PubChem CID | 5290708 |
| Molecular Formula | C18H16F2N6O10 |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-4,6-dinitrobenzamide;4-fluoro-N,N-dimethyl-2,6-dinitrobenzamide |
| SMILES | CN(C)C(=O)c1c(F)cc([N+](=O)[O-])cc1[N+](=O)[O-].CN(C)C(=O)c1c([N+](=O)[O-])cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/2C9H8FN3O5/c1-11(2)9(14)8-6(10)3-5(12(15)16)4-7(8)13(17)18;1-11(2)9(14)8-6(12(15)16)3-5(10)4-7(8)13(17)18/h2*3-4H,1-2H3 |
| InChIKey | NZXYTGHYBRCKQA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|