4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride

C8H6Cl2N2O7S2 — CID 163601250

IUPAC4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride
SMILESCC(=O)Nc1cc([N+](=O)[O-])c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C8H6Cl2N2O7S2/c1-4(13)11-5-2-6(12(14)15)8(21(10,18)19)3-7(5)20(9,16)17/h2-3H,1H3,(H,11,13)
InChIKeyGXVPNYDWYKXCMO-UHFFFAOYSA-N
MW377.18 g/mol
LogP1.41
Rot. Bonds4

About 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride

4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride (PubChem CID 163601250) has the molecular formula C8H6Cl2N2O7S2 and a molecular weight of 377.18 g/mol. Its IUPAC name is 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride.

Molecular Properties

Compound Name4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride
PubChem CID163601250
Molecular FormulaC8H6Cl2N2O7S2
Molecular Weight377.18 g/mol
Exact Mass375.90
IUPAC Name4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride
SMILESCC(=O)Nc1cc([N+](=O)[O-])c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C8H6Cl2N2O7S2/c1-4(13)11-5-2-6(12(14)15)8(21(10,18)19)3-7(5)20(9,16)17/h2-3H,1H3,(H,11,13)
InChIKeyGXVPNYDWYKXCMO-UHFFFAOYSA-N
XLogP1.41
TPSA140.52 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500377.18
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride?
The IUPAC name of 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride (CID 163601250) is 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride.
What is the SMILES notation for 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride?
The canonical SMILES for 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride is CC(=O)Nc1cc([N+](=O)[O-])c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl.
What is the InChIKey of 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride?
The InChIKey is GXVPNYDWYKXCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O7S2/c1-4(13)11-5-2-6(12(14)15)8(21(10,18)19)3-7(5)20(9,16)17/h2-3H,1H3,(H,11,13).
What are the key properties of 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride?
4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride has a molecular weight of 377.18 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride is sourced from PubChem (CID 163601250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).