C8H6Cl2N2O7S2 — CID 163601250
4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride (PubChem CID 163601250) has the molecular formula C8H6Cl2N2O7S2 and a molecular weight of 377.18 g/mol. Its IUPAC name is 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride.
| Compound Name | 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride |
|---|---|
| PubChem CID | 163601250 |
| Molecular Formula | C8H6Cl2N2O7S2 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 4-acetamido-6-nitrobenzene-1,3-disulfonyl chloride |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])c(S(=O)(=O)Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H6Cl2N2O7S2/c1-4(13)11-5-2-6(12(14)15)8(21(10,18)19)3-7(5)20(9,16)17/h2-3H,1H3,(H,11,13) |
| InChIKey | GXVPNYDWYKXCMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|