2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride

C8H6Cl3NO5S2 — CID 91622942

IUPAC2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride
SMILESCC(=O)Nc1cc(S(=O)(=O)Cl)c(Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C8H6Cl3NO5S2/c1-4(13)12-6-3-7(18(10,14)15)5(9)2-8(6)19(11,16)17/h2-3H,1H3,(H,12,13)
InChIKeyLGGGFUCBLCTJJG-UHFFFAOYSA-N
MW366.63 g/mol
LogP2.15
Rot. Bonds3

About 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride

2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride (PubChem CID 91622942) has the molecular formula C8H6Cl3NO5S2 and a molecular weight of 366.63 g/mol. Its IUPAC name is 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride.

Molecular Properties

Compound Name2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride
PubChem CID91622942
Molecular FormulaC8H6Cl3NO5S2
Molecular Weight366.63 g/mol
Exact Mass364.88
IUPAC Name2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride
SMILESCC(=O)Nc1cc(S(=O)(=O)Cl)c(Cl)cc1S(=O)(=O)Cl
InChIInChI=1S/C8H6Cl3NO5S2/c1-4(13)12-6-3-7(18(10,14)15)5(9)2-8(6)19(11,16)17/h2-3H,1H3,(H,12,13)
InChIKeyLGGGFUCBLCTJJG-UHFFFAOYSA-N
XLogP2.15
TPSA97.38 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.63
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride?
The IUPAC name of 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride (CID 91622942) is 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride.
What is the SMILES notation for 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride?
The canonical SMILES for 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride is CC(=O)Nc1cc(S(=O)(=O)Cl)c(Cl)cc1S(=O)(=O)Cl.
What is the InChIKey of 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride?
The InChIKey is LGGGFUCBLCTJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl3NO5S2/c1-4(13)12-6-3-7(18(10,14)15)5(9)2-8(6)19(11,16)17/h2-3H,1H3,(H,12,13).
What are the key properties of 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride?
2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride has a molecular weight of 366.63 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride is sourced from PubChem (CID 91622942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).