C8H6Cl3NO5S2 — CID 91622942
2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride (PubChem CID 91622942) has the molecular formula C8H6Cl3NO5S2 and a molecular weight of 366.63 g/mol. Its IUPAC name is 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride.
| Compound Name | 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride |
|---|---|
| PubChem CID | 91622942 |
| Molecular Formula | C8H6Cl3NO5S2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 2-acetamido-5-chlorobenzene-1,4-disulfonyl chloride |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)Cl)c(Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H6Cl3NO5S2/c1-4(13)12-6-3-7(18(10,14)15)5(9)2-8(6)19(11,16)17/h2-3H,1H3,(H,12,13) |
| InChIKey | LGGGFUCBLCTJJG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |