C15H13IO4 — CID 87800826
2-(2-hydroxy-3,4-dimethoxyphenyl)-3-iodobenzaldehyde (PubChem CID 87800826) has the molecular formula C15H13IO4 and a molecular weight of 384.17 g/mol. Its IUPAC name is 2-(2-hydroxy-3,4-dimethoxyphenyl)-3-iodobenzaldehyde.
| Compound Name | 2-(2-hydroxy-3,4-dimethoxyphenyl)-3-iodobenzaldehyde |
|---|---|
| PubChem CID | 87800826 |
| Molecular Formula | C15H13IO4 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 2-(2-hydroxy-3,4-dimethoxyphenyl)-3-iodobenzaldehyde |
| SMILES | COc1ccc(-c2c(I)cccc2C=O)c(O)c1OC |
| InChI | InChI=1S/C15H13IO4/c1-19-12-7-6-10(14(18)15(12)20-2)13-9(8-17)4-3-5-11(13)16/h3-8,18H,1-2H3 |
| InChIKey | UGQBDPPOIDDLKT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|