C9H11F2NO2 — CID 84777069
2,6-difluoro-3-methoxy-4-(methylaminomethyl)phenol (PubChem CID 84777069) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2,6-difluoro-3-methoxy-4-(methylaminomethyl)phenol.
| Compound Name | 2,6-difluoro-3-methoxy-4-(methylaminomethyl)phenol |
|---|---|
| PubChem CID | 84777069 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2,6-difluoro-3-methoxy-4-(methylaminomethyl)phenol |
| SMILES | CNCc1cc(F)c(O)c(F)c1OC |
| InChI | InChI=1S/C9H11F2NO2/c1-12-4-5-3-6(10)8(13)7(11)9(5)14-2/h3,12-13H,4H2,1-2H3 |
| InChIKey | MYZHLNJDZQCBJD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |