C11H16BrNO3 — CID 96709380
1-(5-bromo-2,3,4-trimethoxyphenyl)-N-methylmethanamine (PubChem CID 96709380) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 1-(5-bromo-2,3,4-trimethoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-2,3,4-trimethoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 96709380 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-(5-bromo-2,3,4-trimethoxyphenyl)-N-methylmethanamine |
| SMILES | CNCc1cc(Br)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C11H16BrNO3/c1-13-6-7-5-8(12)10(15-3)11(16-4)9(7)14-2/h5,13H,6H2,1-4H3 |
| InChIKey | FVTNRCTVUZSAOO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |