C11H13BrO4 — CID 117466771
2-(5-bromo-3,4-dimethoxy-2-methylphenyl)acetic acid (PubChem CID 117466771) has the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-(5-bromo-3,4-dimethoxy-2-methylphenyl)acetic acid.
| Compound Name | 2-(5-bromo-3,4-dimethoxy-2-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 117466771 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(5-bromo-3,4-dimethoxy-2-methylphenyl)acetic acid |
| SMILES | COc1c(Br)cc(CC(=O)O)c(C)c1OC |
| InChI | InChI=1S/C11H13BrO4/c1-6-7(5-9(13)14)4-8(12)11(16-3)10(6)15-2/h4H,5H2,1-3H3,(H,13,14) |
| InChIKey | JBAYIIQGQQTXDK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |