C25H29BrO3Si — CID 89128924
[1-(5-bromo-3,4-dimethoxy-2-methylphenyl)-2-methylpropan-2-yl]-hydroxy-diphenylsilane (PubChem CID 89128924) has the molecular formula C25H29BrO3Si and a molecular weight of 485.49 g/mol. Its IUPAC name is [1-(5-bromo-3,4-dimethoxy-2-methylphenyl)-2-methylpropan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [1-(5-bromo-3,4-dimethoxy-2-methylphenyl)-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 89128924 |
| Molecular Formula | C25H29BrO3Si |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [1-(5-bromo-3,4-dimethoxy-2-methylphenyl)-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
| SMILES | COc1c(Br)cc(CC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)c(C)c1OC |
| InChI | InChI=1S/C25H29BrO3Si/c1-18-19(16-22(26)24(29-5)23(18)28-4)17-25(2,3)30(27,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,27H,17H2,1-5H3 |
| InChIKey | XLYFETOUOZMZLJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|