C12H18BrNO3 — CID 96709381
N-[(5-bromo-2,3,4-trimethoxyphenyl)methyl]ethanamine (PubChem CID 96709381) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is N-[(5-bromo-2,3,4-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-2,3,4-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 96709381 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-[(5-bromo-2,3,4-trimethoxyphenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(Br)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C12H18BrNO3/c1-5-14-7-8-6-9(13)11(16-3)12(17-4)10(8)15-2/h6,14H,5,7H2,1-4H3 |
| InChIKey | NYSAXXUASSTHMO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |