C12H17BrO3S — CID 83925670
3-(5-bromo-2,3,4-trimethoxyphenyl)propane-1-thiol (PubChem CID 83925670) has the molecular formula C12H17BrO3S and a molecular weight of 321.24 g/mol. Its IUPAC name is 3-(5-bromo-2,3,4-trimethoxyphenyl)propane-1-thiol.
| Compound Name | 3-(5-bromo-2,3,4-trimethoxyphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 83925670 |
| Molecular Formula | C12H17BrO3S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-(5-bromo-2,3,4-trimethoxyphenyl)propane-1-thiol |
| SMILES | COc1c(Br)cc(CCCS)c(OC)c1OC |
| InChI | InChI=1S/C12H17BrO3S/c1-14-10-8(5-4-6-17)7-9(13)11(15-2)12(10)16-3/h7,17H,4-6H2,1-3H3 |
| InChIKey | DHHAJJKIJXXUBT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|