C9H12FNO2 — CID 84769618
2-fluoro-4-methyl-6-(methylaminomethyl)benzene-1,3-diol (PubChem CID 84769618) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-fluoro-4-methyl-6-(methylaminomethyl)benzene-1,3-diol.
| Compound Name | 2-fluoro-4-methyl-6-(methylaminomethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 84769618 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-fluoro-4-methyl-6-(methylaminomethyl)benzene-1,3-diol |
| SMILES | CNCc1cc(C)c(O)c(F)c1O |
| InChI | InChI=1S/C9H12FNO2/c1-5-3-6(4-11-2)9(13)7(10)8(5)12/h3,11-13H,4H2,1-2H3 |
| InChIKey | VRTNJBSQTQNJKI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|