C10H14FNO — CID 84769029
2-fluoro-3,6-dimethyl-5-(methylaminomethyl)phenol (PubChem CID 84769029) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-fluoro-3,6-dimethyl-5-(methylaminomethyl)phenol.
| Compound Name | 2-fluoro-3,6-dimethyl-5-(methylaminomethyl)phenol |
|---|---|
| PubChem CID | 84769029 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-fluoro-3,6-dimethyl-5-(methylaminomethyl)phenol |
| SMILES | CNCc1cc(C)c(F)c(O)c1C |
| InChI | InChI=1S/C10H14FNO/c1-6-4-8(5-12-3)7(2)10(13)9(6)11/h4,12-13H,5H2,1-3H3 |
| InChIKey | NYICXAHEKKZRHF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |