C8H6ClF3O — CID 131010984
1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene (PubChem CID 131010984) has the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. Its IUPAC name is 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene.
| Compound Name | 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 131010984 |
| Molecular Formula | C8H6ClF3O |
| Molecular Weight | 210.58 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene |
| SMILES | COc1c(CCl)cc(F)c(F)c1F |
| InChI | InChI=1S/C8H6ClF3O/c1-13-8-4(3-9)2-5(10)6(11)7(8)12/h2H,3H2,1H3 |
| InChIKey | HDYTURZGIHTEOR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|