About 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene
1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene (PubChem CID 131010984) has the molecular formula C8H6ClF3O
and a molecular weight of 210.58 g/mol. Its IUPAC name is 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene |
| PubChem CID | 131010984 |
| Molecular Formula | C8H6ClF3O |
| Molecular Weight | 210.58 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene |
| SMILES | COc1c(CCl)cc(F)c(F)c1F |
| InChI | InChI=1S/C8H6ClF3O/c1-13-8-4(3-9)2-5(10)6(11)7(8)12/h2H,3H2,1H3 |
| InChIKey | HDYTURZGIHTEOR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene?
The IUPAC name of 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene (CID 131010984) is 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene.
What is the SMILES notation for 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene?
The canonical SMILES for 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene is COc1c(CCl)cc(F)c(F)c1F.
What is the InChIKey of 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene?
The InChIKey is HDYTURZGIHTEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3O/c1-13-8-4(3-9)2-5(10)6(11)7(8)12/h2H,3H2,1H3.
What are the key properties of 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene?
1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene has a molecular weight of 210.58 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-3,4,5-trifluoro-2-methoxybenzene is sourced from PubChem (CID 131010984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).