C11H11F5N2O — CID 115564289
N-ethyl-3-(2,3,4,5,6-pentafluoroanilino)propanamide (PubChem CID 115564289) has the molecular formula C11H11F5N2O and a molecular weight of 282.21 g/mol. Its IUPAC name is N-ethyl-3-(2,3,4,5,6-pentafluoroanilino)propanamide.
| Compound Name | N-ethyl-3-(2,3,4,5,6-pentafluoroanilino)propanamide |
|---|---|
| PubChem CID | 115564289 |
| Molecular Formula | C11H11F5N2O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-ethyl-3-(2,3,4,5,6-pentafluoroanilino)propanamide |
| SMILES | CCNC(=O)CCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2O/c1-2-17-5(19)3-4-18-11-9(15)7(13)6(12)8(14)10(11)16/h18H,2-4H2,1H3,(H,17,19) |
| InChIKey | CDFUNAOQIICPMI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|