C11H15FN2O — CID 62324389
N-ethyl-3-(4-fluoroanilino)propanamide (PubChem CID 62324389) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is N-ethyl-3-(4-fluoroanilino)propanamide.
| Compound Name | N-ethyl-3-(4-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 62324389 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-ethyl-3-(4-fluoroanilino)propanamide |
| SMILES | CCNC(=O)CCNc1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2O/c1-2-13-11(15)7-8-14-10-5-3-9(12)4-6-10/h3-6,14H,2,7-8H2,1H3,(H,13,15) |
| InChIKey | KNEIWNXGTVAVRZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |