C12H18N2OS — CID 107644721
N-ethyl-3-(2-methylsulfanylanilino)propanamide (PubChem CID 107644721) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N-ethyl-3-(2-methylsulfanylanilino)propanamide.
| Compound Name | N-ethyl-3-(2-methylsulfanylanilino)propanamide |
|---|---|
| PubChem CID | 107644721 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-ethyl-3-(2-methylsulfanylanilino)propanamide |
| SMILES | CCNC(=O)CCNc1ccccc1SC |
| InChI | InChI=1S/C12H18N2OS/c1-3-13-12(15)8-9-14-10-6-4-5-7-11(10)16-2/h4-7,14H,3,8-9H2,1-2H3,(H,13,15) |
| InChIKey | UZQPFEYSXCJGLV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |