C11H16N2O4S — CID 71367834
N'-(2-methylsulfanylphenyl)ethane-1,2-diamine;oxalic acid (PubChem CID 71367834) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is N'-(2-methylsulfanylphenyl)ethane-1,2-diamine;oxalic acid.
| Compound Name | N'-(2-methylsulfanylphenyl)ethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 71367834 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N'-(2-methylsulfanylphenyl)ethane-1,2-diamine;oxalic acid |
| SMILES | CSc1ccccc1NCCN.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H14N2S.C2H2O4/c1-12-9-5-3-2-4-8(9)11-7-6-10;3-1(4)2(5)6/h2-5,11H,6-7,10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | WXIPGUMPJJQFPN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|