C12H17Cl2NO — CID 107679023
2,6-dichloro-4-(3-methylpentan-2-ylamino)phenol (PubChem CID 107679023) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-methylpentan-2-ylamino)phenol.
| Compound Name | 2,6-dichloro-4-(3-methylpentan-2-ylamino)phenol |
|---|---|
| PubChem CID | 107679023 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2,6-dichloro-4-(3-methylpentan-2-ylamino)phenol |
| SMILES | CCC(C)C(C)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO/c1-4-7(2)8(3)15-9-5-10(13)12(16)11(14)6-9/h5-8,15-16H,4H2,1-3H3 |
| InChIKey | UGWISZQMDAMFSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|