C13H19Cl2N — CID 104726239
2,5-dichloro-4-methyl-N-(3-methylpentan-2-yl)aniline (PubChem CID 104726239) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is 2,5-dichloro-4-methyl-N-(3-methylpentan-2-yl)aniline.
| Compound Name | 2,5-dichloro-4-methyl-N-(3-methylpentan-2-yl)aniline |
|---|---|
| PubChem CID | 104726239 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2,5-dichloro-4-methyl-N-(3-methylpentan-2-yl)aniline |
| SMILES | CCC(C)C(C)Nc1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N/c1-5-8(2)10(4)16-13-7-11(14)9(3)6-12(13)15/h6-8,10,16H,5H2,1-4H3 |
| InChIKey | XEWGOIAHDQBHLG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |