C10H10Cl2N2 — CID 104726846
2-(2,5-dichloro-4-methylanilino)propanenitrile (PubChem CID 104726846) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-methylanilino)propanenitrile.
| Compound Name | 2-(2,5-dichloro-4-methylanilino)propanenitrile |
|---|---|
| PubChem CID | 104726846 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(2,5-dichloro-4-methylanilino)propanenitrile |
| SMILES | Cc1cc(Cl)c(NC(C)C#N)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2/c1-6-3-9(12)10(4-8(6)11)14-7(2)5-13/h3-4,7,14H,1-2H3 |
| InChIKey | SEWLZSPKFOMBKJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |