C13H17Cl2F2NO — CID 63449963
3,5-dichloro-4-(difluoromethoxy)-N-(3-methylpentan-2-yl)aniline (PubChem CID 63449963) has the molecular formula C13H17Cl2F2NO and a molecular weight of 312.19 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-(3-methylpentan-2-yl)aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-(3-methylpentan-2-yl)aniline |
|---|---|
| PubChem CID | 63449963 |
| Molecular Formula | C13H17Cl2F2NO |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-(3-methylpentan-2-yl)aniline |
| SMILES | CCC(C)C(C)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2F2NO/c1-4-7(2)8(3)18-9-5-10(14)12(11(15)6-9)19-13(16)17/h5-8,13,18H,4H2,1-3H3 |
| InChIKey | IWEYOOUYIKMFLD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|