C13H11Cl2F2NO2 — CID 60935902
3,5-dichloro-4-(difluoromethoxy)-N-[1-(furan-2-yl)ethyl]aniline (PubChem CID 60935902) has the molecular formula C13H11Cl2F2NO2 and a molecular weight of 322.14 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-[1-(furan-2-yl)ethyl]aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-[1-(furan-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 60935902 |
| Molecular Formula | C13H11Cl2F2NO2 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-[1-(furan-2-yl)ethyl]aniline |
| SMILES | CC(Nc1cc(Cl)c(OC(F)F)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C13H11Cl2F2NO2/c1-7(11-3-2-4-19-11)18-8-5-9(14)12(10(15)6-8)20-13(16)17/h2-7,13,18H,1H3 |
| InChIKey | JEVZTBGXPDYPRJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|