C13H12Cl2F2N2OS — CID 60935520
3,5-dichloro-4-(difluoromethoxy)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 60935520) has the molecular formula C13H12Cl2F2N2OS and a molecular weight of 353.22 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 60935520 |
| Molecular Formula | C13H12Cl2F2N2OS |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | Cc1nc(C(C)Nc2cc(Cl)c(OC(F)F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C13H12Cl2F2N2OS/c1-6(11-5-21-7(2)19-11)18-8-3-9(14)12(10(15)4-8)20-13(16)17/h3-6,13,18H,1-2H3 |
| InChIKey | POOJECIZTOHSBG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|