C13H12Cl2F2N2O — CID 66397700
3,5-dichloro-4-(difluoromethoxy)-N-[(1-methylpyrrol-3-yl)methyl]aniline (PubChem CID 66397700) has the molecular formula C13H12Cl2F2N2O and a molecular weight of 321.15 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methylpyrrol-3-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methylpyrrol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 66397700 |
| Molecular Formula | C13H12Cl2F2N2O |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methylpyrrol-3-yl)methyl]aniline |
| SMILES | Cn1ccc(CNc2cc(Cl)c(OC(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H12Cl2F2N2O/c1-19-3-2-8(7-19)6-18-9-4-10(14)12(11(15)5-9)20-13(16)17/h2-5,7,13,18H,6H2,1H3 |
| InChIKey | WTMBNJOTUWLJKJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|