C12H11Cl2F2N3O — CID 62743219
3,5-dichloro-4-(difluoromethoxy)-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline (PubChem CID 62743219) has the molecular formula C12H11Cl2F2N3O and a molecular weight of 322.14 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62743219 |
| Molecular Formula | C12H11Cl2F2N3O |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline |
| SMILES | Cc1[nH]cnc1CNc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2F2N3O/c1-6-10(19-5-18-6)4-17-7-2-8(13)11(9(14)3-7)20-12(15)16/h2-3,5,12,17H,4H2,1H3,(H,18,19) |
| InChIKey | NQONEJWTRVIUDM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|