C11H10Cl2F2N4O — CID 62755449
3,5-dichloro-4-(difluoromethoxy)-N-[(1-methyltriazol-4-yl)methyl]aniline (PubChem CID 62755449) has the molecular formula C11H10Cl2F2N4O and a molecular weight of 323.13 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methyltriazol-4-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methyltriazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62755449 |
| Molecular Formula | C11H10Cl2F2N4O |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-[(1-methyltriazol-4-yl)methyl]aniline |
| SMILES | Cn1cc(CNc2cc(Cl)c(OC(F)F)c(Cl)c2)nn1 |
| InChI | InChI=1S/C11H10Cl2F2N4O/c1-19-5-7(17-18-19)4-16-6-2-8(12)10(9(13)3-6)20-11(14)15/h2-3,5,11,16H,4H2,1H3 |
| InChIKey | LRIQINIGNFNSCB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|