C12H9Cl2F2NOS — CID 54864800
3,5-dichloro-4-(difluoromethoxy)-N-(thiophen-2-ylmethyl)aniline (PubChem CID 54864800) has the molecular formula C12H9Cl2F2NOS and a molecular weight of 324.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 54864800 |
| Molecular Formula | C12H9Cl2F2NOS |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-(thiophen-2-ylmethyl)aniline |
| SMILES | FC(F)Oc1c(Cl)cc(NCc2cccs2)cc1Cl |
| InChI | InChI=1S/C12H9Cl2F2NOS/c13-9-4-7(17-6-8-2-1-3-19-8)5-10(14)11(9)18-12(15)16/h1-5,12,17H,6H2 |
| InChIKey | VYZNJQAGWMKEGW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|