C12H15Cl2F2NO2 — CID 116501176
3,5-dichloro-4-(difluoromethoxy)-N-(3-methoxy-2-methylpropyl)aniline (PubChem CID 116501176) has the molecular formula C12H15Cl2F2NO2 and a molecular weight of 314.16 g/mol. Its IUPAC name is 3,5-dichloro-4-(difluoromethoxy)-N-(3-methoxy-2-methylpropyl)aniline.
| Compound Name | 3,5-dichloro-4-(difluoromethoxy)-N-(3-methoxy-2-methylpropyl)aniline |
|---|---|
| PubChem CID | 116501176 |
| Molecular Formula | C12H15Cl2F2NO2 |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3,5-dichloro-4-(difluoromethoxy)-N-(3-methoxy-2-methylpropyl)aniline |
| SMILES | COCC(C)CNc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2F2NO2/c1-7(6-18-2)5-17-8-3-9(13)11(10(14)4-8)19-12(15)16/h3-4,7,12,17H,5-6H2,1-2H3 |
| InChIKey | HTLXWARYZDNOFX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|