C11H14F3NO — CID 116501289
3,4,5-trifluoro-N-(3-methoxy-2-methylpropyl)aniline (PubChem CID 116501289) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(3-methoxy-2-methylpropyl)aniline.
| Compound Name | 3,4,5-trifluoro-N-(3-methoxy-2-methylpropyl)aniline |
|---|---|
| PubChem CID | 116501289 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3,4,5-trifluoro-N-(3-methoxy-2-methylpropyl)aniline |
| SMILES | COCC(C)CNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H14F3NO/c1-7(6-16-2)5-15-8-3-9(12)11(14)10(13)4-8/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | AFPCKBFDSAXRFX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|