C14H23NO4 — CID 116500691
3,4,5-trimethoxy-N-(3-methoxy-2-methylpropyl)aniline (PubChem CID 116500691) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(3-methoxy-2-methylpropyl)aniline.
| Compound Name | 3,4,5-trimethoxy-N-(3-methoxy-2-methylpropyl)aniline |
|---|---|
| PubChem CID | 116500691 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-(3-methoxy-2-methylpropyl)aniline |
| SMILES | COCC(C)CNc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H23NO4/c1-10(9-16-2)8-15-11-6-12(17-3)14(19-5)13(7-11)18-4/h6-7,10,15H,8-9H2,1-5H3 |
| InChIKey | UFYAAIAYRVGGQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|