C10H12F3N — CID 62809579
3,4,5-trifluoro-N-(2-methylpropyl)aniline (PubChem CID 62809579) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(2-methylpropyl)aniline.
| Compound Name | 3,4,5-trifluoro-N-(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 62809579 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3,4,5-trifluoro-N-(2-methylpropyl)aniline |
| SMILES | CC(C)CNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H12F3N/c1-6(2)5-14-7-3-8(11)10(13)9(12)4-7/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | BCWCPCDEMYIGID-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|