C10H10F3NO3 — CID 103249545
3-hydroxy-4-(3,4,5-trifluoroanilino)butanoic acid (PubChem CID 103249545) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 3-hydroxy-4-(3,4,5-trifluoroanilino)butanoic acid.
| Compound Name | 3-hydroxy-4-(3,4,5-trifluoroanilino)butanoic acid |
|---|---|
| PubChem CID | 103249545 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-hydroxy-4-(3,4,5-trifluoroanilino)butanoic acid |
| SMILES | O=C(O)CC(O)CNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H10F3NO3/c11-7-1-5(2-8(12)10(7)13)14-4-6(15)3-9(16)17/h1-2,6,14-15H,3-4H2,(H,16,17) |
| InChIKey | NQRSJRSEXKXLOI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|