C13H19F3N2O — CID 62810463
1-(diethylamino)-3-(3,4,5-trifluoroanilino)propan-2-ol (PubChem CID 62810463) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-(diethylamino)-3-(3,4,5-trifluoroanilino)propan-2-ol.
| Compound Name | 1-(diethylamino)-3-(3,4,5-trifluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 62810463 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(diethylamino)-3-(3,4,5-trifluoroanilino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H19F3N2O/c1-3-18(4-2)8-10(19)7-17-9-5-11(14)13(16)12(15)6-9/h5-6,10,17,19H,3-4,7-8H2,1-2H3 |
| InChIKey | SSPZKEGRUULPPZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|